CAS 1352398-11-8
:Ethyl 4-oxo-4H-thiopyrano[2,3-b]pyridine-3-carboxylate
Description:
Ethyl 4-oxo-4H-thiopyrano[2,3-b]pyridine-3-carboxylate is a heterocyclic compound characterized by its unique structure, which includes a thiopyrano ring fused to a pyridine moiety. This compound features a carbonyl group (ketone) at the 4-position of the thiopyrano ring and an ethyl ester functional group at the carboxylate position. The presence of both sulfur and nitrogen in its structure contributes to its potential reactivity and biological activity. Ethyl 4-oxo-4H-thiopyrano[2,3-b]pyridine-3-carboxylate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in various chemical reactions or as a potential drug candidate. As with many heterocycles, the electronic properties imparted by the nitrogen and sulfur atoms can influence its reactivity and interactions with biological targets.
Formula:C11H9NO3S
InChI:InChI=1S/C11H9NO3S/c1-2-15-11(14)8-6-16-10-7(9(8)13)4-3-5-12-10/h3-6H,2H2,1H3
InChI key:InChIKey=WLCAFBMYIIFJHB-UHFFFAOYSA-N
SMILES:O=C1C=2C(SC=C1C(OCC)=O)=NC=CC2
Synonyms:- Ethyl 4-oxo-4H-thiopyrano[2,3-b]pyridine-3-carboxylate
- 4H-Thiopyrano[2,3-b]pyridine-3-carboxylic acid, 4-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.