
CAS 1352398-23-2
:1H-Indazole, 5-bromo-7-fluoro-3-iodo-
Description:
1H-Indazole, 5-bromo-7-fluoro-3-iodo- is a heterocyclic organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of bromine, fluorine, and iodine substituents at specific positions on the indazole ring significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit various physical properties such as solubility in organic solvents, depending on the nature of the substituents. The halogen atoms can impart unique characteristics, such as increased lipophilicity and potential for participation in halogen bonding interactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, including halogenation reactions and purification methods. Overall, 1H-Indazole, 5-bromo-7-fluoro-3-iodo- represents a complex structure with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C7H3BrFIN2
InChI:InChI=1S/C7H3BrFIN2/c8-3-1-4-6(5(9)2-3)11-12-7(4)10/h1-2H,(H,11,12)
InChI key:InChIKey=ADRYMWXNNJMMIC-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(Br)=C1)C(I)=NN2
Synonyms:- 1H-Indazole, 5-bromo-7-fluoro-3-iodo-
- 5-Bromo-7-fluoro-3-iodo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.