CAS 1352398-49-2
:7-Methyl-1H-indazole-3-methanol
Description:
7-Methyl-1H-indazole-3-methanol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methyl group at the 7-position and a hydroxymethyl group at the 3-position contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the hydroxymethyl group, which enhances its hydrophilicity. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The indazole framework is known for its potential in various applications, including as a scaffold for drug development. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. As with many organic compounds, its stability and reactivity can be affected by environmental conditions such as temperature and pH. Overall, 7-Methyl-1H-indazole-3-methanol represents a versatile structure with potential applications in research and industry.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-3-2-4-7-8(5-12)10-11-9(6)7/h2-4,12H,5H2,1H3,(H,10,11)
InChI key:InChIKey=ILZDBQVYWXIAEA-UHFFFAOYSA-N
SMILES:C(O)C=1C=2C(=C(C)C=CC2)NN1
Synonyms:- 7-Methyl-1H-indazole-3-methanol
- 1H-Indazole-3-methanol, 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.