CAS 1352398-50-5

Methyl 4-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate

Description:

Methyl 4-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features an amino group at the 4-position and a carboxylate ester at the 5-position, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylate group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrrolo-pyridine structures have been associated with various pharmacological activities. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic contexts. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-14-9(13)6-4-12-8-5(7(6)10)2-3-11-8/h2-4H,1H3,(H3,10,11,12)

InChI key: InChIKey=WVTPGLYHEXJHEZ-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=C1C(OC)=O)NC=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 4-amino-, methyl ester
• Methyl 4-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate