
CAS 1352398-56-1
:5-Methoxyimidazo[1,2-a]pyridine-2-carboxylic acid
Description:
5-Methoxyimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures, which contribute to its unique chemical properties. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH), enhancing its solubility in polar solvents and influencing its reactivity. The presence of the imidazo and pyridine moieties suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's structure allows for various interactions, such as hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, its molecular framework may facilitate the development of derivatives with tailored pharmacological properties. As with many heterocycles, the compound may exhibit interesting electronic properties, potentially making it useful in materials science or as a ligand in coordination chemistry. Overall, 5-Methoxyimidazo[1,2-a]pyridine-2-carboxylic acid represents a versatile scaffold for further research and application in various chemical fields.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-14-8-4-2-3-7-10-6(9(12)13)5-11(7)8/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=VYFUMCCVBVAUDV-UHFFFAOYSA-N
SMILES:O(C)C=1N2C(=NC(C(O)=O)=C2)C=CC1
Synonyms:- 5-Methoxyimidazo[1,2-a]pyridine-2-carboxylic acid
- Imidazo[1,2-a]pyridine-2-carboxylic acid, 5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.