CAS 135242-71-6
:3-HYDROXY-4-IODOBENZALDEHYDE
Description:
3-Hydroxy-4-iodobenzaldehyde is an organic compound characterized by the presence of a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring that also contains an iodine atom. This compound typically appears as a solid and is soluble in organic solvents. Its molecular structure suggests it may exhibit both aromatic and polar characteristics, influencing its reactivity and interactions in chemical reactions. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the aldehyde group is reactive, making it a potential candidate for various organic synthesis applications. The presence of iodine can also impart unique properties, such as increased reactivity in nucleophilic substitution reactions. Additionally, 3-hydroxy-4-iodobenzaldehyde may have applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C7H5IO2
InChI:InChI=1/C7H5IO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H
SMILES:c1cc(c(cc1C=O)O)I
Synonyms:- Rarechem Ax Ki 1030
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Hydroxy-4-iodobenzaldehyde
CAS:Formula:C7H5IO2Purity:97%Color and Shape:SolidMolecular weight:248.01793-Hydroxy-4-iodobenzaldehyde
CAS:3-Hydroxy-4-iodobenzaldehydeFormula:C7H5IO2Purity:98%Color and Shape: light orange powderMolecular weight:248.02g/mol3-Hydroxy-4-iodobenzaldehyde
CAS:3-Hydroxy-4-iodobenzaldehyde is a fluorophore that is used in the synthesis of amide compounds, as well as in the production of other synthetic molecules. 3-Hydroxy-4-iodobenzaldehyde has been shown to have pharmacokinetic properties that are similar to those of fluorescein, and can be used to study the distribution and metabolism of this compound. This compound also has an oxidation potential that is higher than that of fluorescein, which makes it more useful for studying drug metabolism. The labile nature of 3-hydroxy-4-iodobenzaldehyde means it will not remain intact for long periods of time.Formula:C7H5IO2Purity:Min. 95%Color and Shape:PowderMolecular weight:248.02 g/mol3-Hydroxy-4-iodobenzaldehyde
CAS:Formula:C7H5IO2Purity:98%Color and Shape:SolidMolecular weight:248.019



