CAS 1352443-50-5

3,6-Dibromo-8-quinolinecarbonitrile

Description:

3,6-Dibromo-8-quinolinecarbonitrile is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with bromine atoms and a cyano group. This compound typically exhibits properties associated with halogenated heterocycles, such as increased reactivity and potential for forming coordination complexes. The presence of bromine atoms enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The cyano group contributes to its polarity and can influence solubility in organic solvents. Additionally, compounds like 3,6-Dibromo-8-quinolinecarbonitrile may exhibit biological activity, making them of interest in medicinal chemistry and material science. Its specific applications can vary, but it may serve as an intermediate in the synthesis of more complex molecules or as a potential candidate for pharmaceutical development. As with many brominated compounds, considerations regarding environmental impact and toxicity are important in its handling and application.

Formula: C₁₀H₄Br₂N₂

InChI: InChI=1S/C10H4Br2N2/c11-8-1-6-2-9(12)5-14-10(6)7(3-8)4-13/h1-3,5H

InChI key: InChIKey=NMLNNRKPALHLIC-UHFFFAOYSA-N

SMILES: C(#N)C=1C2=C(C=C(Br)C1)C=C(Br)C=N2

Synonyms:

• 3,6-Dibromo-8-quinolinecarbonitrile
• 8-Quinolinecarbonitrile, 3,6-dibromo-