CAS 135248-51-0

2-chloro-2-fluoro-N-(2-(4-nitrophenyl)ethyl)acetamide

Description:

2-Chloro-2-fluoro-N-(2-(4-nitrophenyl)ethyl)acetamide is a synthetic organic compound characterized by its unique functional groups and structural features. It contains a chloro and a fluoro substituent on the carbon adjacent to the acetamide group, which can influence its reactivity and polarity. The presence of the nitrophenyl group introduces significant electron-withdrawing characteristics, enhancing the compound's potential for various chemical reactions, including nucleophilic substitutions. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the acetamide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both halogen and nitro groups, which can modulate biological activity. Additionally, the compound's stability and reactivity may be influenced by the steric and electronic effects of its substituents, making it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₀H₁₀ClFN₂O₃

InChI: InChI=1/C10H10ClFN2O3/c11-9(12)10(15)13-6-5-7-1-3-8(4-2-7)14(16)17/h1-4,9H,5-6H2,(H,13,15)

SMILES: c1cc(ccc1CCN=C(C(Cl)F)O)N(=O)=O

Synonyms:

• N-(2-p-Nitrophenethyl)chlorofluoroacetamide
• Pno2CFA
• Acetamide, 2-chloro-2-fluoro-N-(2-(4-nitrophenyl)ethyl)-