CAS 1352496-37-7

4-Methyl-5-(1-propyl-2-pyrrolidinyl)-2(1H)-pyridinone

Description:

4-Methyl-5-(1-propyl-2-pyrrolidinyl)-2(1H)-pyridinone, identified by its CAS number 1352496-37-7, is a chemical compound that belongs to the class of pyridinones. This substance features a pyridine ring substituted with a methyl group and a pyrrolidine moiety, which contributes to its unique structural and chemical properties. The presence of the pyrrolidine group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological activities, although specific biological effects would depend on its interactions at the molecular level. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Further research would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c1-3-6-15-7-4-5-12(15)11-9-14-13(16)8-10(11)2/h8-9,12H,3-7H2,1-2H3,(H,14,16)

InChI key: InChIKey=ZFEMYJOQQHGSKV-UHFFFAOYSA-N

SMILES: C(CC)N1C(CCC1)C=2C(C)=CC(=O)NC2

Synonyms:

• 2(1H)-Pyridinone, 4-methyl-5-(1-propyl-2-pyrrolidinyl)-
• 4-Methyl-5-(1-propyl-2-pyrrolidinyl)-2(1H)-pyridinone