
CAS 1352519-94-8
:1-[2-(6-Chloro-2-methyl-3-pyridinyl)-1-piperidinyl]ethanone
Description:
1-[2-(6-Chloro-2-methyl-3-pyridinyl)-1-piperidinyl]ethanone, with the CAS number 1352519-94-8, is a chemical compound characterized by its complex structure that includes a piperidine ring and a pyridine moiety. The presence of a chloro group and a methyl group on the pyridine ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as being a solid or liquid at room temperature, depending on its specific formulation and purity. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's molecular interactions may be influenced by its steric and electronic properties, making it a candidate for further research in drug design and synthesis. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can impart toxicity and environmental concerns.
Formula:C13H17ClN2O
InChI:InChI=1S/C13H17ClN2O/c1-9-11(6-7-13(14)15-9)12-5-3-4-8-16(12)10(2)17/h6-7,12H,3-5,8H2,1-2H3
InChI key:InChIKey=OCEQYHSDTPLGOL-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C(CCCC1)C2=C(C)N=C(Cl)C=C2
Synonyms:- Ethanone, 1-[2-(6-chloro-2-methyl-3-pyridinyl)-1-piperidinyl]-
- 1-[2-(6-Chloro-2-methyl-3-pyridinyl)-1-piperidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.