CymitQuimica logo

CAS 1352524-65-2

:

5-(4-Propylphenyl)-2-oxazolecarboxaldehyde

Description:
5-(4-Propylphenyl)-2-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a propylphenyl group, indicating the presence of a propyl chain attached to a phenyl ring, which contributes to its hydrophobic characteristics. The aldehyde functional group (-CHO) is also present, making it reactive and capable of participating in various chemical reactions, such as condensation and oxidation. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its unique combination of functional groups may also impart interesting optical or electronic properties, making it a candidate for research in materials science. Additionally, the presence of the oxazole moiety can enhance biological activity, which is often explored in medicinal chemistry. Overall, 5-(4-Propylphenyl)-2-oxazolecarboxaldehyde is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c1-2-3-10-4-6-11(7-5-10)12-8-14-13(9-15)16-12/h4-9H,2-3H2,1H3
InChI key:InChIKey=OOLRIHYCTNCKHB-UHFFFAOYSA-N
SMILES:C(=O)C=1OC(=CN1)C2=CC=C(CCC)C=C2
Synonyms:
  • 5-(4-Propylphenyl)-2-oxazolecarboxaldehyde
  • 2-Oxazolecarboxaldehyde, 5-(4-propylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.