CAS 1352526-32-9

2-[(1,1-Dimethylethyl)thio]-3-[1-[(4-methylphenyl)sulfonyl]-2-piperidinyl]pyridine

Description:

The chemical substance known as 2-[(1,1-Dimethylethyl)thio]-3-[1-[(4-methylphenyl)sulfonyl]-2-piperidinyl]pyridine, with the CAS number 1352526-32-9, is characterized by its complex molecular structure, which includes a pyridine ring substituted with a thioether and a piperidine moiety. This compound features a tert-butylthio group, contributing to its lipophilicity and potential biological activity. The presence of a sulfonyl group attached to a 4-methylphenyl ring enhances its reactivity and may influence its pharmacokinetic properties. The piperidine ring is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its unique combination of functional groups suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and solubility characteristics would be essential for its formulation and delivery in therapeutic contexts. Overall, this substance exemplifies the intricate design often found in bioactive molecules, highlighting the interplay between structure and function in chemical compounds.

Formula: C₂₁H₂₈N₂O₂S₂

InChI: InChI=1S/C21H28N2O2S2/c1-16-10-12-17(13-11-16)27(24,25)23-15-6-5-9-19(23)18-8-7-14-22-20(18)26-21(2,3)4/h7-8,10-14,19H,5-6,9,15H2,1-4H3

InChI key: InChIKey=IBHDTFPBCAUHPQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(CCCC1)C2=C(SC(C)(C)C)N=CC=C2)C3=CC=C(C)C=C3

Synonyms:

• Pyridine, 2-[(1,1-dimethylethyl)thio]-3-[1-[(4-methylphenyl)sulfonyl]-2-piperidinyl]-
• 2-[(1,1-Dimethylethyl)thio]-3-[1-[(4-methylphenyl)sulfonyl]-2-piperidinyl]pyridine