CymitQuimica logo

CAS 1352530-42-7

:

1-[(5-Bromo-4-phenoxy-3-pyridinyl)sulfonyl]-4-methylpiperazine

Description:
1-[(5-Bromo-4-phenoxy-3-pyridinyl)sulfonyl]-4-methylpiperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with a methyl group and a sulfonyl group linked to a pyridine derivative. The presence of the bromine atom and the phenoxy group contributes to its unique reactivity and potential biological activity. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activity against specific biological targets. Its sulfonamide functional group can enhance solubility and bioavailability, making it a candidate for drug development. The molecular interactions of this compound, including hydrogen bonding and π-π stacking due to the aromatic systems, play a crucial role in its efficacy and mechanism of action. As with many synthetic compounds, understanding its stability, solubility, and potential toxicity is essential for evaluating its suitability for therapeutic applications.
Formula:C16H18BrN3O3S
InChI:InChI=1S/C16H18BrN3O3S/c1-19-7-9-20(10-8-19)24(21,22)15-12-18-11-14(17)16(15)23-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3
InChI key:InChIKey=YAOJKVFAZZASEC-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C(OC2=CC=CC=C2)=C(Br)C=NC1)N3CCN(C)CC3
Synonyms:
  • Piperazine, 1-[(5-bromo-4-phenoxy-3-pyridinyl)sulfonyl]-4-methyl-
  • 1-[(5-Bromo-4-phenoxy-3-pyridinyl)sulfonyl]-4-methylpiperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.