CAS 1352530-97-2

3-Bromo-4-chloro-5-(1-piperidinylsulfonyl)pyridine

Description:

3-Bromo-4-chloro-5-(1-piperidinylsulfonyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom at the 3-position, a chlorine atom at the 4-position, and a piperidinylsulfonyl group at the 5-position. This compound exhibits properties typical of halogenated pyridines, including potential reactivity in nucleophilic substitution reactions due to the presence of the halogen substituents. The piperidinylsulfonyl moiety may enhance its solubility in polar solvents and contribute to its biological activity, making it of interest in medicinal chemistry. The sulfonyl group can also serve as a site for further chemical modifications. Additionally, the presence of both bromine and chlorine atoms can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₀H₁₂BrClN₂O₂S

InChI: InChI=1S/C10H12BrClN2O2S/c11-8-6-13-7-9(10(8)12)17(15,16)14-4-2-1-3-5-14/h6-7H,1-5H2

InChI key: InChIKey=LLWMHMXJEDXACI-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1C(Cl)=C(Br)C=NC1)N2CCCCC2

Synonyms:

• Pyridine, 3-bromo-4-chloro-5-(1-piperidinylsulfonyl)-
• 3-Bromo-4-chloro-5-(1-piperidinylsulfonyl)pyridine