CAS 1352546-87-2
:Phenylmethyl 5-amino-2-azaspiro[3.3]heptane-2-carboxylate
Description:
Phenylmethyl 5-amino-2-azaspiro[3.3]heptane-2-carboxylate, identified by its CAS number 1352546-87-2, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in the ring system, contributing to its azaspiro classification. This compound features an amino group, which can participate in various chemical reactions, and a carboxylate moiety that may influence its solubility and reactivity. The presence of the phenylmethyl group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its spirocyclic nature often imparts distinctive conformational properties, which can affect its pharmacological profile. The compound may exhibit specific stereochemistry, influencing its biological activity and interactions with receptors or enzymes. Overall, the characteristics of this compound suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although further studies would be necessary to elucidate its full biological profile and therapeutic potential.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c15-12-6-7-14(12)9-16(10-14)13(17)18-8-11-4-2-1-3-5-11/h1-5,12H,6-10,15H2
InChI key:InChIKey=FMCGNVMCATULGB-UHFFFAOYSA-N
SMILES:NC1C2(CN(C(OCC3=CC=CC=C3)=O)C2)CC1
Synonyms:- 2-Azaspiro[3.3]heptane-2-carboxylic acid, 5-amino-, phenylmethyl ester
- Phenylmethyl 5-amino-2-azaspiro[3.3]heptane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.