CAS 13526-66-4

3-Bromo-6-chloroimidazo[1,2-b]pyridazine

Description:

3-Bromo-6-chloroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate solubility in organic solvents, reflecting its polar nature due to the nitrogen atoms in the ring structure. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's structure allows for potential interactions with biological targets, which can be explored through various synthetic modifications. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical investigations. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact. Overall, 3-Bromo-6-chloroimidazo[1,2-b]pyridazine represents a valuable compound in the field of medicinal chemistry and materials science.

Formula: C₆H₃BrClN₃

InChI: InChI=1/C6H3BrClN3/c7-4-3-9-6-2-1-5(8)10-11(4)6/h1-3H

SMILES: c1cc2ncc(Br)n2nc1Cl

3-Bromo-6-chloroimidazo[1,2-b]pyridazine, 95%

CAS: 13526-66-4

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₆H₃BrClN₃

Purity: 95%

Molecular weight: 232.47

Ref: 02-H66531

3-Bromo-6-chloroimidazo[1,2-b]pyridazine

CAS: 13526-66-4

Formula: C₆H₃BrClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.4651

Ref: IN-DA003J3J

3-Bromo-6-chloroimidazo[1,2-b]pyridazine

CAS: 13526-66-4

3-Bromo-6-chloroimidazo[1,2-b]pyridazine

Formula: C₆H₃BrClN₃

Purity: 98%

Color and Shape: white to light yellow solid

Molecular weight: 232.47g/mol

Ref: 54-OR7413

3-Bromo-6-chloro-imidazo[1,2-b]pyridazine

CAS: 13526-66-4

Formula: C₆H₃BrClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.47

Ref: 10-F048736