CAS 13526-66-4
:3-Bromo-6-chloroimidazo[1,2-b]pyridazine
Description:
3-Bromo-6-chloroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate solubility in organic solvents, reflecting its polar nature due to the nitrogen atoms in the ring structure. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's structure allows for potential interactions with biological targets, which can be explored through various synthetic modifications. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical investigations. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact. Overall, 3-Bromo-6-chloroimidazo[1,2-b]pyridazine represents a valuable compound in the field of medicinal chemistry and materials science.
Formula:C6H3BrClN3
InChI:InChI=1/C6H3BrClN3/c7-4-3-9-6-2-1-5(8)10-11(4)6/h1-3H
SMILES:c1cc2ncc(Br)n2nc1Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-6-chloroimidazo[1,2-b]pyridazine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrClN3Purity:95%Molecular weight:232.473-Bromo-6-chloroimidazo[1,2-b]pyridazine
CAS:Formula:C6H3BrClN3Purity:97%Color and Shape:SolidMolecular weight:232.46513-Bromo-6-chloroimidazo[1,2-b]pyridazine
CAS:3-Bromo-6-chloroimidazo[1,2-b]pyridazineFormula:C6H3BrClN3Purity:98%Color and Shape: white to light yellow solidMolecular weight:232.47g/mol3-Bromo-6-chloro-imidazo[1,2-b]pyridazine
CAS:Formula:C6H3BrClN3Purity:97%Color and Shape:SolidMolecular weight:232.47



