
CAS 13526-67-5
:Imidazo[1,2-b]pyridazine, 3-bromo-6-chloro-, hydrochloride (1:1)
Description:
Imidazo[1,2-b]pyridazine, 3-bromo-6-chloro-, hydrochloride (1:1) is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, enhances its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the halogen substituents, making it a valuable candidate for further research in drug development and synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C6H3BrClN3·ClH
InChI:InChI=1S/C6H3BrClN3.ClH/c7-4-3-9-6-2-1-5(8)10-11(4)6;/h1-3H;1H
InChI key:InChIKey=DCLVMZQEDGDZCJ-UHFFFAOYSA-N
SMILES:BrC=1N2C(C=CC(Cl)=N2)=NC1.Cl
Synonyms:- Imidazo[1,2-b]pyridazine, 3-bromo-6-chloro-, monohydrochloride
- Imidazo[1,2-b]pyridazine, 3-bromo-6-chloro-, hydrochloride (1:1)
- 3-Bromo-6-chloroimidazo[1,2-b]pyridazine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.