
CAS 1352609-93-8
:3-Amino-5-(dimethylamino)benzonitrile
Description:
3-Amino-5-(dimethylamino)benzonitrile is an organic compound characterized by its aromatic structure, which includes an amino group and a dimethylamino group attached to a benzonitrile framework. The presence of the amino group contributes to its potential as a base, while the dimethylamino group enhances its nucleophilicity and solubility in polar solvents. This compound typically exhibits a solid state at room temperature and may have a moderate melting point. Its chemical properties suggest it could participate in various reactions, such as nucleophilic substitutions or coupling reactions, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the nitrile functional group may impart specific reactivity, allowing for further derivatization. Safety data should be consulted, as compounds with amino and nitrile functionalities can pose health risks if not handled properly. Overall, 3-Amino-5-(dimethylamino)benzonitrile is a versatile compound with applications in chemical research and industry.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c1-12(2)9-4-7(6-10)3-8(11)5-9/h3-5H,11H2,1-2H3
InChI key:InChIKey=CGVDPFBMXKDLPJ-UHFFFAOYSA-N
SMILES:N(C)(C)C1=CC(C#N)=CC(N)=C1
Synonyms:- 3-Amino-5-(dimethylamino)benzonitrile
- Benzonitrile, 3-amino-5-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.