CymitQuimica logo

CAS 135267-12-8

:

2-[(1R)-1-[(2R)-2-(2,4-Difluorophenyl)-2-oxiranyl]ethoxy]tetrahydro-2H-pyran

Description:
2-[(1R)-1-[(2R)-2-(2,4-Difluorophenyl)-2-oxiranyl]ethoxy]tetrahydro-2H-pyran, with CAS number 135267-12-8, is a complex organic compound characterized by its unique structural features, including a tetrahydropyran ring and an epoxide group. The presence of a difluorophenyl substituent contributes to its potential biological activity and lipophilicity. This compound is likely to exhibit specific stereochemistry due to the presence of chiral centers, which can influence its reactivity and interaction with biological targets. The ethoxy group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and drug development. Additionally, the compound's structural complexity may lead to interesting pharmacological properties, warranting further investigation into its potential therapeutic uses. Overall, the combination of functional groups and stereochemistry in this molecule suggests it could play a role in the development of novel pharmaceuticals or agrochemicals.
Formula:C15H18F2O3
InChI:InChI=1S/C15H18F2O3/c1-10(20-14-4-2-3-7-18-14)15(9-19-15)12-6-5-11(16)8-13(12)17/h5-6,8,10,14H,2-4,7,9H2,1H3/t10-,14?,15-/m1/s1
InChI key:InChIKey=PWBIMUAZFIPFKO-GIFVDNBISA-N
SMILES:[C@@H](OC1CCCCO1)(C)[C@]2(CO2)C3=C(F)C=C(F)C=C3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.