CymitQuimica logo

CAS 1352717-90-8

:

8-Bromo-6-fluoro-2-methyl-4H-3,1-benzoxazin-4-one

Description:
8-Bromo-6-fluoro-2-methyl-4H-3,1-benzoxazin-4-one is a synthetic organic compound characterized by its unique heterocyclic structure, which includes a benzoxazine ring. This compound features a bromine atom and a fluorine atom, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the methyl group enhances its lipophilicity, which can influence its biological activity and solubility properties. The benzoxazine moiety is known for its stability and ability to undergo various chemical transformations, making it a valuable scaffold in drug design. Additionally, the compound may exhibit interesting pharmacological properties, potentially acting as an antimicrobial or anticancer agent, although specific biological activities would require empirical investigation. Its CAS number, 1352717-90-8, allows for easy identification in chemical databases, facilitating research and development in fields such as pharmaceuticals and agrochemicals. Overall, 8-Bromo-6-fluoro-2-methyl-4H-3,1-benzoxazin-4-one represents a versatile compound with promising applications in various chemical and biological contexts.
Formula:C9H5BrFNO2
InChI:InChI=1S/C9H5BrFNO2/c1-4-12-8-6(9(13)14-4)2-5(11)3-7(8)10/h2-3H,1H3
InChI key:InChIKey=BBRMBQATYWQGGT-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(C)O1)=C(Br)C=C(F)C2
Synonyms:
  • 8-Bromo-6-fluoro-2-methyl-4H-3,1-benzoxazin-4-one
  • 4H-3,1-Benzoxazin-4-one, 8-bromo-6-fluoro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.