CymitQuimica logo

CAS 1352719-70-0

:

3-Bromo-4-hydroxy-5-methylbenzenepropanoic acid

Description:
3-Bromo-4-hydroxy-5-methylbenzenepropanoic acid, also known by its CAS number 1352719-70-0, is an organic compound characterized by its aromatic structure, which includes a bromine atom, a hydroxyl group, and a methyl group attached to a benzene ring. This compound features a propanoic acid functional group, contributing to its acidic properties. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various chemical syntheses. The hydroxyl group imparts polar characteristics, which can influence solubility in polar solvents. Additionally, the methyl group can affect the steric hindrance and overall stability of the molecule. This compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Its unique combination of functional groups suggests potential for diverse chemical reactivity, including electrophilic aromatic substitution and esterification reactions. As with any chemical substance, safety data and handling precautions should be observed due to its potential hazards.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-6-4-7(2-3-9(12)13)5-8(11)10(6)14/h4-5,14H,2-3H2,1H3,(H,12,13)
InChI key:InChIKey=UHLZWQRBIQSTNN-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CC(Br)=C(O)C(C)=C1
Synonyms:
  • 3-Bromo-4-hydroxy-5-methylbenzenepropanoic acid
  • Benzenepropanoic acid, 3-bromo-4-hydroxy-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.