CAS 1352723-52-4
:[1,2,4]Triazolo[1,5-a]pyridine, 2-bromo-7-methyl-
Description:
[1,2,4]Triazolo[1,5-a]pyridine, 2-bromo-7-methyl- is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyridine ring. This compound features a bromine atom at the 2-position and a methyl group at the 7-position of the triazolo-pyridine structure, which can influence its chemical reactivity and biological activity. The presence of the bromine atom typically enhances the compound's lipophilicity and can serve as a site for further chemical modifications. The methyl group may affect the steric hindrance and electronic properties of the molecule. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its unique structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in research and industry.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c1-5-2-3-11-6(4-5)9-7(8)10-11/h2-4H,1H3
InChI key:InChIKey=WLGXBGDLTKSZAA-UHFFFAOYSA-N
SMILES:BrC1=NN2C(=N1)C=C(C)C=C2
Synonyms:- [1,2,4]Triazolo[1,5-a]pyridine, 2-bromo-7-methyl-
- 2-Bromo-7-methyl-[1,2,4]triazolo[1,5-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.