CAS 1352723-60-4
:1,1-Dimethylethyl 2,5-dihydro-3-hydroxy-2,2-dimethyl-5-oxo-1H-pyrrole-1-carboxylate
Description:
1,1-Dimethylethyl 2,5-dihydro-3-hydroxy-2,2-dimethyl-5-oxo-1H-pyrrole-1-carboxylate, identified by its CAS number 1352723-60-4, is a chemical compound that features a pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. This compound is characterized by the presence of multiple functional groups, including a carboxylate ester and a hydroxyl group, contributing to its potential reactivity and solubility properties. The dimethyl and tert-butyl substituents enhance its steric bulk, which can influence its interactions in biological systems or chemical reactions. The presence of the keto group (5-oxo) suggests potential for tautomerization or reactivity in condensation reactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that could impart specific biological activities. However, detailed studies on its physical properties, such as melting point, boiling point, and solubility, would be necessary to fully characterize its behavior in various environments.
Formula:C11H17NO4
InChI:InChI=1S/C11H17NO4/c1-10(2,3)16-9(15)12-8(14)6-7(13)11(12,4)5/h6,13H,1-5H3
InChI key:InChIKey=JDAJEPNYICNNBM-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(C)(C)C(O)=CC1=O
Synonyms:- 1,1-Dimethylethyl 2,5-dihydro-3-hydroxy-2,2-dimethyl-5-oxo-1H-pyrrole-1-carboxylate
- 1H-Pyrrole-1-carboxylic acid, 2,5-dihydro-3-hydroxy-2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Hydroxy-2,2-dimethyl-5-oxo-2,5-dihydro-pyrrole-1-carboxylic acid tert-butyl ester
CAS:Formula:C11H17NO4Molecular weight:227.2570
