
CAS 1352723-66-0
:6-Bromo-7-chloro-3-(3,5-dimethylphenyl)-4(1H)-cinnolinone
Description:
6-Bromo-7-chloro-3-(3,5-dimethylphenyl)-4(1H)-cinnolinone is a synthetic organic compound characterized by its complex structure, which includes a cinnolinone core substituted with bromine and chlorine atoms, as well as a dimethylphenyl group. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature. The presence of halogen substituents (bromine and chlorine) often influences its reactivity and potential biological activity, making it of interest in medicinal chemistry. The dimethylphenyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, compounds of this type may exhibit various biological activities, including antimicrobial or anticancer properties, although specific activity would depend on further empirical studies. The molecular structure suggests potential for interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C16H12BrClN2O
InChI:InChI=1S/C16H12BrClN2O/c1-8-3-9(2)5-10(4-8)15-16(21)11-6-12(17)13(18)7-14(11)19-20-15/h3-7H,1-2H3,(H,19,21)
InChI key:InChIKey=QTTGPXOLSRVIOU-UHFFFAOYSA-N
SMILES:O=C1C(=NNC=2C1=CC(Br)=C(Cl)C2)C3=CC(C)=CC(C)=C3
Synonyms:- 4(1H)-Cinnolinone, 6-bromo-7-chloro-3-(3,5-dimethylphenyl)-
- 6-Bromo-7-chloro-3-(3,5-dimethylphenyl)-4(1H)-cinnolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Bromo-7-chloro-3-(3,5-dimethylphenyl)cinnolin-4(1H)-one
CAS:Formula:C16H12BrClN2OMolecular weight:363.6363
