CAS 1352743-83-9
:1-(4,6-Dibromo-3-fluorothieno[3,4-b]thien-2-yl)-2-ethyl-1-hexanone
Description:
1-(4,6-Dibromo-3-fluorothieno[3,4-b]thien-2-yl)-2-ethyl-1-hexanone is a complex organic compound characterized by its unique thieno[3,4-b]thiene structure, which incorporates multiple halogen substituents, specifically bromine and fluorine. This compound features a ketone functional group, indicated by the presence of the hexanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of bromine and fluorine atoms enhances its electronic properties, making it of interest in materials science and medicinal chemistry. The ethyl group attached to the ketone adds to its hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the compound's structural complexity may impart unique optical or electronic properties, making it a candidate for research in fields such as organic electronics or photonics. Overall, its distinctive features and functional groups suggest potential utility in various chemical applications, although specific behavior and reactivity would depend on the context of its use.
Formula:C14H15Br2FOS2
InChI:1/C14H15Br2FOS2/c1-3-5-6-7(4-2)10(18)12-9(17)8-11(19-12)14(16)20-13(8)15/h7H,3-6H2,1-2H3
Synonyms:- K0509
- 1-(4,6-Dibromo-3-fluorothieno[3,4-b]thiophen-2-yl)-2ethylhexan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.