
CAS 1352890-63-1
:3H-Imidazo[4,5-b]pyridine-5-carbonitrile
Description:
3H-Imidazo[4,5-b]pyridine-5-carbonitrile is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carbonitrile functional group, which enhances its reactivity and potential applications in various chemical reactions. The presence of nitrogen atoms in the ring structure imparts basicity and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding and coordination with metal ions, which can be advantageous in catalysis and material science. Additionally, the compound may exhibit fluorescence or other photophysical properties, depending on its environment and substituents. Due to its structural features, 3H-Imidazo[4,5-b]pyridine-5-carbonitrile may serve as a scaffold for the development of pharmaceuticals, particularly in the search for new therapeutic agents targeting various diseases. Overall, its unique characteristics make it a valuable compound for research and development in both organic synthesis and drug discovery.
Formula:C7H4N4
InChI:InChI=1S/C7H4N4/c8-3-5-1-2-6-7(11-5)10-4-9-6/h1-2,4H,(H,9,10,11)
InChI key:InChIKey=XQIAEVCIIYOZLM-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C2C(=CC1)NC=N2
Synonyms:- 3H-Imidazo[4,5-b]pyridine-5-carbonitrile
- 1H-Imidazo[4,5-b]pyridine-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.