
CAS 135290-21-0
:2-[3-(Dimethylamino)phenoxy]acetonitrile
Description:
2-[3-(Dimethylamino)phenoxy]acetonitrile, with the CAS number 135290-21-0, is an organic compound characterized by its unique molecular structure, which includes a phenoxy group and a nitrile functional group. This compound typically exhibits a moderate polarity due to the presence of both the dimethylamino group and the acetonitrile moiety. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The dimethylamino group can impart basic properties, making the compound potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the nitrile group can enhance the compound's reactivity and solubility in organic solvents. Its specific physical properties, such as melting point, boiling point, and solubility, can vary based on the conditions and purity of the substance. Overall, 2-[3-(Dimethylamino)phenoxy]acetonitrile is a versatile compound with applications in medicinal chemistry and related fields.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-12(2)9-4-3-5-10(8-9)13-7-6-11/h3-5,8H,7H2,1-2H3
InChI key:InChIKey=BFBJJANSNYSBPE-UHFFFAOYSA-N
SMILES:O(CC#N)C1=CC(N(C)C)=CC=C1
Synonyms:- Acetonitrile, 2-[3-(dimethylamino)phenoxy]-
- 2-[3-(Dimethylamino)phenoxy]acetonitrile
- Acetonitrile, [3-(dimethylamino)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.