CAS 1352925-64-4
:4-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carbonitrile
Description:
4-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a methyl group at the 3-position contributes to its unique reactivity and potential biological activity. The phenylmethyl group at the 1-position enhances its lipophilicity, which may influence its interaction with biological targets. Additionally, the carbonitrile functional group at the 5-position introduces a polar character, which can affect solubility and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific enzyme systems or receptors. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH, temperature, and solvent. Safety and handling precautions should be observed due to the presence of bromine and the potential toxicity of the carbonitrile group.
Formula:C12H10BrN3
InChI:InChI=1S/C12H10BrN3/c1-9-12(13)11(7-14)16(15-9)8-10-5-3-2-4-6-10/h2-6H,8H2,1H3
InChI key:InChIKey=NRTCMOCVKZLIBI-UHFFFAOYSA-N
SMILES:C(N1C(C#N)=C(Br)C(C)=N1)C2=CC=CC=C2
Synonyms:- 1H-Pyrazole-5-carbonitrile, 4-bromo-3-methyl-1-(phenylmethyl)-
- 4-Bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-BENZYL-4-BROMO-3-METHYL-1H-PYRAZOLE-5-CARBONITRILE
CAS:Formula:C12H10BrN3Purity:%Molecular weight:276.1319
