CAS 1352925-69-9
:Methyl 2-amino-8-methoxy-5-quinazolinecarboxylate
Description:
Methyl 2-amino-8-methoxy-5-quinazolinecarboxylate is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features an amino group and a methoxy group, contributing to its potential biological activity and solubility properties. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. Methyl 2-amino-8-methoxy-5-quinazolinecarboxylate may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's solubility and stability in various solvents can influence its application in research and industry. As with many quinazoline derivatives, it may also serve as a scaffold for further chemical modifications to enhance its efficacy or selectivity in biological systems.
Formula:C11H11N3O3
InChI:InChI=1S/C11H11N3O3/c1-16-8-4-3-6(10(15)17-2)7-5-13-11(12)14-9(7)8/h3-5H,1-2H3,(H2,12,13,14)
InChI key:InChIKey=HTVOFKQDVUDZNH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(C(OC)=CC1)N=C(N)N=C2
Synonyms:- Methyl 2-amino-8-methoxy-5-quinazolinecarboxylate
- 5-Quinazolinecarboxylic acid, 2-amino-8-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
