CAS 1352925-94-0

Ethyl 4-bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carboxylate

Description:

Ethyl 4-bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a bromine substituent at the 4-position and a methyl group at the 3-position of the pyrazole ring, contributing to its unique reactivity and potential biological activity. The presence of the ethyl ester group at the 5-position enhances its solubility and reactivity, making it suitable for various synthetic applications. Additionally, the phenylmethyl group attached to the nitrogen atom of the pyrazole ring adds to its structural complexity and may influence its pharmacological properties. This compound is of interest in medicinal chemistry and may exhibit various biological activities, including anti-inflammatory or antimicrobial effects. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Overall, this compound represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₁₄H₁₅BrN₂O₂

InChI: InChI=1S/C14H15BrN2O2/c1-3-19-14(18)13-12(15)10(2)16-17(13)9-11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3

InChI key: InChIKey=YBYYBJIFMRRSDI-UHFFFAOYSA-N

SMILES: C(N1C(C(OCC)=O)=C(Br)C(C)=N1)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 4-bromo-3-methyl-1-(phenylmethyl)-, ethyl ester
• Ethyl 4-bromo-3-methyl-1-(phenylmethyl)-1H-pyrazole-5-carboxylate

Ethyl 1-benzyl-4-bromo-3-methyl-1H-pyrazole-5-carboxylate

CAS: 1352925-94-0

Ethyl 1-benzyl-4-bromo-3-methyl-1H-pyrazole-5-carboxylate

Purity: 98%

Molecular weight: 323.19g/mol

Ref: 54-OR1059866