CymitQuimica logo

CAS 1352934-00-9

:

1-Chloro-7-(trifluoromethyl)phthalazine

Description:
1-Chloro-7-(trifluoromethyl)phthalazine is a chemical compound characterized by its unique structure, which includes a phthalazine core substituted with a chlorine atom and a trifluoromethyl group. This compound belongs to the class of heterocyclic aromatic compounds, specifically phthalazines, which are known for their potential applications in pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom contributes to the compound's reactivity and can participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound's fluorinated group can impart unique electronic properties, affecting its interaction with biological targets. Overall, 1-Chloro-7-(trifluoromethyl)phthalazine exhibits characteristics that make it a subject of interest for further research in synthetic chemistry and potential applications in drug development. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C9H4ClF3N2
InChI:InChI=1S/C9H4ClF3N2/c10-8-7-3-6(9(11,12)13)2-1-5(7)4-14-15-8/h1-4H
InChI key:InChIKey=YHOKQYHXGUDNIC-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(C(F)(F)F)=C2)C=NN1
Synonyms:
  • 1-Chloro-7-(trifluoromethyl)phthalazine
  • Phthalazine, 1-chloro-7-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.