CAS 1352999-05-3

N-(5-Chloro-4-methyl-2-benzothiazolyl)-N-methylglycine

Description:

N-(5-Chloro-4-methyl-2-benzothiazolyl)-N-methylglycine, identified by its CAS number 1352999-05-3, is a chemical compound that belongs to the class of benzothiazole derivatives. This substance features a benzothiazole ring, which is a fused bicyclic structure containing both a benzene and a thiazole ring, contributing to its unique chemical properties. The presence of a chloro group and a methyl group on the benzothiazole ring enhances its reactivity and solubility in various solvents. The N-methylglycine moiety indicates that it possesses an amino acid-like structure, which may influence its biological activity and potential applications. This compound is often studied for its potential use in agricultural chemistry, particularly as a herbicide or plant growth regulator, due to its ability to interact with specific biological pathways in plants. Its characteristics, including solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other substances. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.

Formula: C₁₁H₁₁ClN₂O₂S

InChI: InChI=1S/C11H11ClN2O2S/c1-6-7(12)3-4-8-10(6)13-11(17-8)14(2)5-9(15)16/h3-4H,5H2,1-2H3,(H,15,16)

InChI key: InChIKey=FBYURQHDSIRDHH-UHFFFAOYSA-N

SMILES: CC1=C2C(SC(N(CC(O)=O)C)=N2)=CC=C1Cl

Synonyms:

• N-(5-Chloro-4-methyl-2-benzothiazolyl)-N-methylglycine
• Glycine, N-(5-chloro-4-methyl-2-benzothiazolyl)-N-methyl-