CAS 1352999-18-8
:N-(5,7-Dimethyl-2-benzothiazolyl)-N-methylglycine
Description:
N-(5,7-Dimethyl-2-benzothiazolyl)-N-methylglycine, identified by its CAS number 1352999-18-8, is a chemical compound that features a benzothiazole moiety substituted with methyl groups and a glycine derivative. This compound is characterized by its unique structure, which combines both aromatic and heterocyclic elements, contributing to its potential biological activity. The presence of the benzothiazole ring often imparts properties such as fluorescence and the ability to interact with biological systems, making it of interest in various fields, including pharmaceuticals and agrochemicals. The N-methylglycine component suggests that it may exhibit properties related to amino acids, potentially influencing its solubility and reactivity. Additionally, the dimethyl substitutions can enhance lipophilicity, affecting the compound's distribution in biological systems. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the context of its applications in medicinal chemistry and its interactions within biological pathways.
Formula:C12H14N2O2S
InChI:InChI=1S/C12H14N2O2S/c1-7-4-8(2)11-9(5-7)13-12(17-11)14(3)6-10(15)16/h4-5H,6H2,1-3H3,(H,15,16)
InChI key:InChIKey=PUWYWFPVUYBQSP-UHFFFAOYSA-N
SMILES:CC1=C2C(N=C(N(CC(O)=O)C)S2)=CC(C)=C1
Synonyms:- N-(5,7-Dimethyl-2-benzothiazolyl)-N-methylglycine
- Glycine, N-(5,7-dimethyl-2-benzothiazolyl)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.