CAS 1352999-79-1
:N-(6-Methoxy-2-benzothiazolyl)-N-methylglycine
Description:
N-(6-Methoxy-2-benzothiazolyl)-N-methylglycine, identified by its CAS number 1352999-79-1, is a chemical compound that features a benzothiazole moiety substituted with a methoxy group and an N-methylglycine functional group. This compound typically exhibits properties associated with both its aromatic and heterocyclic structures, which may contribute to its potential biological activity. The presence of the methoxy group can enhance lipophilicity, potentially influencing its solubility and permeability in biological systems. The benzothiazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. Additionally, the N-methylglycine portion may impart characteristics related to amino acids, possibly affecting its interaction with biological targets. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, although specific biological activities and mechanisms would require further investigation through empirical studies.
Formula:C11H12N2O3S
InChI:InChI=1S/C11H12N2O3S/c1-13(6-10(14)15)11-12-8-4-3-7(16-2)5-9(8)17-11/h3-5H,6H2,1-2H3,(H,14,15)
InChI key:InChIKey=DSDRAUGWQHHBJU-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C)C1=NC=2C(S1)=CC(OC)=CC2
Synonyms:- Glycine, N-(6-methoxy-2-benzothiazolyl)-N-methyl-
- N-(6-Methoxy-2-benzothiazolyl)-N-methylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.