CAS 1352999-99-5
:N-Methyl-N-(6-methyl-2-benzothiazolyl)glycine
Description:
N-Methyl-N-(6-methyl-2-benzothiazolyl)glycine is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a glycine derivative. This compound typically exhibits properties associated with both the benzothiazole and amino acid functional groups, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amino group. The methyl substitution on the benzothiazole ring can influence its electronic properties and reactivity. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its specific applications and interactions would depend on further studies, including its behavior in biological systems, stability under different conditions, and its reactivity with other chemical entities. As with any chemical substance, safety data and handling precautions should be reviewed before use, particularly in laboratory or industrial settings.
Formula:C11H12N2O2S
InChI:InChI=1S/C11H12N2O2S/c1-7-3-4-8-9(5-7)16-11(12-8)13(2)6-10(14)15/h3-5H,6H2,1-2H3,(H,14,15)
InChI key:InChIKey=STPYRNRCTBRECA-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C)C1=NC=2C(S1)=CC(C)=CC2
Synonyms:- N-Methyl-N-(6-methyl-2-benzothiazolyl)glycine
- Glycine, N-methyl-N-(6-methyl-2-benzothiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.