CAS 1353000-30-2

2-(3-Bromophenyl)quinazoline

Description:

2-(3-Bromophenyl)quinazoline is an organic compound characterized by its quinazoline core, which is a bicyclic structure containing both a benzene and a pyrimidine ring. The presence of a bromine atom at the 3-position of the phenyl group significantly influences its chemical properties, including its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate to high lipophilicity due to the aromatic rings, which can affect its solubility in various solvents. It may also demonstrate biological activity, making it of interest in pharmaceutical research, particularly in the development of anticancer agents or other therapeutic compounds. The molecular structure allows for potential interactions with biological targets, and its halogen substituent can enhance binding affinity or alter pharmacokinetic properties. As with many quinazoline derivatives, it may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed due to the presence of bromine, which can pose health risks.

Formula: C₁₄H₉BrN₂

InChI: InChI=1S/C14H9BrN2/c15-12-6-3-5-10(8-12)14-16-9-11-4-1-2-7-13(11)17-14/h1-9H

InChI key: InChIKey=PVJCZGCZYIBYHA-UHFFFAOYSA-N

SMILES: BrC=1C=C(C2=NC3=C(C=N2)C=CC=C3)C=CC1

Synonyms:

• Quinazoline, 2-(3-bromophenyl)-
• 2-(3-Bromophenyl)quinazoline