CymitQuimica logo

CAS 135302-15-7

:

Butanoic acid, 2-[(methoxyamino)carbonyl]hydrazide

Description:
Butanoic acid, 2-[(methoxyamino)carbonyl]hydrazide, identified by CAS number 135302-15-7, is a chemical compound that features a butanoic acid backbone with a hydrazide functional group. This compound typically exhibits characteristics common to hydrazides, such as the ability to form hydrogen bonds due to the presence of both amine and carbonyl groups, which can influence its solubility and reactivity. The methoxyamino substituent introduces additional polar characteristics, potentially enhancing its solubility in polar solvents. Butanoic acid derivatives are often associated with biological activity, and this compound may exhibit properties relevant to medicinal chemistry, including potential applications in drug development. Its structure suggests it could participate in various chemical reactions, including acylation and condensation, making it a versatile intermediate in organic synthesis. Overall, the unique combination of functional groups in this compound may contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H13N3O3
InChI:InChI=1S/C6H13N3O3/c1-3-4-5(10)7-8-6(11)9-12-2/h3-4H2,1-2H3,(H,7,10)(H2,8,9,11)
InChI key:InChIKey=BQHMORMUJJKOCY-UHFFFAOYSA-N
SMILES:C(NNC(NOC)=O)(CCC)=O
Synonyms:
  • 2-Butyryl-N-methoxyhydrazinecarboxamide
  • Butanoic acid, 2-[(methoxyamino)carbonyl]hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.