
CAS 1353101-02-6
:Methyl 2-cyano-5-methoxy-3-pyridinecarboxylate
Description:
Methyl 2-cyano-5-methoxy-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a cyano group (-CN) and a methoxy group (-OCH3) attached to the pyridine ring, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Its molecular structure suggests that it may exhibit polar characteristics due to the electronegative nitrogen and oxygen atoms, influencing its solubility in polar solvents. Additionally, the compound's functional groups may impart specific biological activities, making it of interest for medicinal chemistry. Overall, Methyl 2-cyano-5-methoxy-3-pyridinecarboxylate is a versatile compound with potential applications in synthetic organic chemistry and drug development.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-13-6-3-7(9(12)14-2)8(4-10)11-5-6/h3,5H,1-2H3
InChI key:InChIKey=UQWPUPCASOVHNB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C#N)N=CC(OC)=C1
Synonyms:- Methyl 2-cyano-5-methoxy-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 2-cyano-5-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.