CAS 1353101-14-0

3-Chloro-N-cyclopropyl-4-pyridinamine

Description:

3-Chloro-N-cyclopropyl-4-pyridinamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 3-position and a cyclopropyl group attached to the nitrogen atom contributes to its unique properties. This compound typically exhibits moderate to high solubility in polar organic solvents due to the polar nature of the pyridine ring and the amine functional group. It may also display basicity due to the nitrogen atom, which can accept protons. The cyclopropyl group can influence the compound's reactivity and steric properties, potentially affecting its interactions in biological systems. As a pyridinamine derivative, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₉ClN₂

InChI: InChI=1S/C8H9ClN2/c9-7-5-10-4-3-8(7)11-6-1-2-6/h3-6H,1-2H2,(H,10,11)

InChI key: InChIKey=VMARRUMQRGENMX-UHFFFAOYSA-N

SMILES: N(C=1C(Cl)=CN=CC1)C2CC2

Synonyms:

• 4-Pyridinamine, 3-chloro-N-cyclopropyl-
• 3-Chloro-N-cyclopropyl-4-pyridinamine