CymitQuimica logo

CAS 1353101-33-3

:

4-Bromo-3-pyridazinamine

Description:
4-Bromo-3-pyridazinamine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and an amino group at the 3-position contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can participate in hydrogen bonding. Its structure suggests potential for biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted to understand its handling and toxicity, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-3-pyridazinamine represents a versatile building block in organic synthesis and drug discovery.
Formula:C4H4BrN3
InChI:InChI=1S/C4H4BrN3/c5-3-1-2-7-8-4(3)6/h1-2H,(H2,6,8)
InChI key:InChIKey=TXDSHENHFNOCMR-UHFFFAOYSA-N
SMILES:BrC1=C(N)N=NC=C1
Synonyms:
  • 3-Pyridazinamine, 4-bromo-
  • 4-Bromo-3-pyridazinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.