CymitQuimica logo

CAS 1353101-50-4

:

5-Bromo-4-thiazolamine

Description:
5-Bromo-4-thiazolamine is a chemical compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features a bromine atom substituted at the 5-position of the thiazole ring and an amino group at the 4-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry and may have applications in drug development, particularly in the synthesis of biologically active molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. As with many thiazole derivatives, it may exhibit antimicrobial or antifungal properties, making it a subject of research in pharmacology and biochemistry. Proper safety measures should be observed when handling this compound due to its potential biological effects.
Formula:C3H3BrN2S
InChI:InChI=1S/C3H3BrN2S/c4-2-3(5)6-1-7-2/h1H,5H2
InChI key:InChIKey=UKJOMPKCVCVOGO-UHFFFAOYSA-N
SMILES:NC1=C(Br)SC=N1
Synonyms:
  • 5-Bromo-4-thiazolamine
  • 4-Thiazolamine, 5-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.