
CAS 1353101-52-6
:Methyl 4-amino-6-bromo-2-pyridinecarboxylate
Description:
Methyl 4-amino-6-bromo-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the amino group (-NH2) at the 4-position and a bromo substituent at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents and can facilitate further chemical modifications. This compound may exhibit biological activity due to its structural features, making it of interest in drug development and synthesis. Its molecular structure suggests potential interactions with biological targets, and the bromine atom may influence its pharmacokinetic properties. As with many pyridine derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c1-12-7(11)5-2-4(9)3-6(8)10-5/h2-3H,1H3,(H2,9,10)
InChI key:InChIKey=SIWLFCWQHIPRLM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(N)=CC(Br)=N1
Synonyms:- Methyl 4-amino-6-bromo-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 4-amino-6-bromo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.