CAS 1353101-84-4

2-Bromo-3-methoxy-5-nitropyridine

Description:

2-Bromo-3-methoxy-5-nitropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom, a methoxy group, and a nitro group. The bromine atom is located at the 2-position, the methoxy group at the 3-position, and the nitro group at the 5-position of the pyridine ring. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its aromatic nature. The presence of the nitro group contributes to its potential reactivity and makes it a candidate for various chemical transformations. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interactions with other substances. 2-Bromo-3-methoxy-5-nitropyridine is of interest in medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of more complex compounds or as a building block in drug development.

Formula: C₆H₅BrN₂O₃

InChI: InChI=1S/C6H5BrN2O3/c1-12-5-2-4(9(10)11)3-8-6(5)7/h2-3H,1H3

InChI key: InChIKey=BWJNSRABTDYPPK-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(N(=O)=O)C=NC1Br

Synonyms:

• 2-Bromo-3-methoxy-5-nitropyridine
• Pyridine, 2-bromo-3-methoxy-5-nitro-

2-Bromo-3-methoxy-5-nitropyridine

CAS: 1353101-84-4

Formula: C₆H₅BrN₂O₃

Molecular weight: 233.0195

Ref: IN-DA019FYC