CAS 1353101-89-9
:4-Amino-5-thiazolecarboxylic acid
Description:
4-Amino-5-thiazolecarboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the thiazole ring, contributing to its acidic and basic properties. It is typically a white to off-white crystalline solid, soluble in water due to the presence of the carboxylic acid group, which can ionize in solution. The compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory properties. Its structure allows for various chemical modifications, making it a versatile building block in synthetic chemistry. Additionally, the presence of the thiazole moiety can enhance the compound's interactions with biological targets, making it a subject of research in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H4N2O2S
InChI:InChI=1S/C4H4N2O2S/c5-3-2(4(7)8)9-1-6-3/h1H,5H2,(H,7,8)
InChI key:InChIKey=PSHKDNUXHXEYDT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)N=CS1
Synonyms:- 5-Thiazolecarboxylic acid, 4-amino-
- 4-Amino-5-thiazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

