CAS 1353101-98-0
:5-(2-Hydroxy-1-methylethyl)-2,4-cyclohexadien-1-one
Description:
5-(2-Hydroxy-1-methylethyl)-2,4-cyclohexadien-1-one, identified by its CAS number 1353101-98-0, is an organic compound characterized by its unique structure, which includes a cyclohexadiene ring and a hydroxyl group. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity due to the presence of the hydroxyl group. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and hydrogen bonding, which can influence its reactivity and stability. The compound's solubility is likely influenced by the presence of the hydroxyl group, making it more soluble in polar solvents. Additionally, its potential applications could span across fields such as pharmaceuticals, agrochemicals, and materials science, where its unique properties may be harnessed for specific functions. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its practical applications and safety profile.
Formula:C9H12O2
InChI:InChI=1S/C9H12O2/c1-7(6-10)8-3-2-4-9(11)5-8/h2-4,7,10H,5-6H2,1H3
InChI key:InChIKey=UXWWXOPFZBZFAF-UHFFFAOYSA-N
SMILES:C(CO)(C)C=1CC(=O)C=CC1
Synonyms:- 2,4-Cyclohexadien-1-one, 5-(2-hydroxy-1-methylethyl)-
- 5-(2-Hydroxy-1-methylethyl)-2,4-cyclohexadien-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
