CymitQuimica logo

CAS 135312-22-0

:

(1S)-2,2′-Dimethoxy[1,1′-binaphthalene]-3,3′-dicarboxylic acid

Description:
(1S)-2,2′-Dimethoxy[1,1′-binaphthalene]-3,3′-dicarboxylic acid is a chiral organic compound characterized by its binaphthalene structure, which consists of two naphthalene units connected by a central carbon atom. This compound features two methoxy groups attached to the 2-position of the binaphthalene framework, enhancing its solubility and reactivity. The presence of two carboxylic acid groups at the 3,3′-positions contributes to its acidity and potential for forming hydrogen bonds, making it useful in various chemical reactions and applications, including asymmetric synthesis and as a chiral auxiliary. The specific stereochemistry indicated by the (1S) designation suggests that it has a defined spatial arrangement, which is crucial for its interactions in biological systems and catalysis. Additionally, the compound's unique structural features may impart interesting optical properties, making it a candidate for studies in materials science and photochemistry. Overall, this compound exemplifies the complexity and utility of chiral organic molecules in modern chemistry.
Formula:C24H18O6
InChI:InChI=1S/C24H18O6/c1-29-21-17(23(25)26)11-13-7-3-5-9-15(13)19(21)20-16-10-6-4-8-14(16)12-18(24(27)28)22(20)30-2/h3-12H,1-2H3,(H,25,26)(H,27,28)
InChI key:InChIKey=GZLIFMUGMGYEKV-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=C(C=C1C(O)=O)C=CC=C2)C=3C4=C(C=C(C(O)=O)C3OC)C=CC=C4
Synonyms:
  • [1,1′-Binaphthalene]-3,3′-dicarboxylic acid, 2,2′-dimethoxy-, (S)-
  • [1,1′-Binaphthalene]-3,3′-dicarboxylic acid, 2,2′-dimethoxy-, (1S)-
  • (1S)-2,2′-Dimethoxy[1,1′-binaphthalene]-3,3′-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.