CAS 13532-37-1: 4-Hydroxyvaleric acid

Description:4-Hydroxyvaleric acid, with the CAS number 13532-37-1, is a carboxylic acid characterized by the presence of a hydroxyl group (-OH) attached to the fourth carbon of a five-carbon straight-chain alkanoic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in water and organic solvents, which enhances its utility in various chemical applications. The presence of both the carboxylic acid and hydroxyl functional groups allows for versatile reactivity, making it a potential candidate for use in the synthesis of esters, polymers, and other organic compounds. Additionally, 4-hydroxyvaleric acid can serve as a building block in biochemical pathways and may have applications in pharmaceuticals and agrochemicals. Its properties, such as boiling point and melting point, can vary based on environmental conditions and the presence of impurities. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₅H₁₀O₃

InChI:InChI=1S/C5H10O3/c1-4(6)2-3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)

InChI key:InChIKey=FMHKPLXYWVCLME-UHFFFAOYSA-N

SMILES:O=C(O)CCC(O)C

Synonyms:
4-Hydroxypentanoic acid
Pentanoic acid, 4-hydroxy-
Valeric acid, 4-hydroxy-
γ-Hydroxyvaleric acid
γ-Methyl-γ-hydroxybutyric acid
4-Hydroxyvaleric acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4-Hydroxypentanoic Acid REF: 4Z-P-219026CAS: 13532-37-1	- - -	To inquire	Wed 02 Apr 25
4-Hydroxypentanoic acid REF: 10-F686168CAS: 13532-37-1	95%	To inquire	Mon 07 Apr 25
4-Hydroxypentanoic acid REF: 3D-NAA53237CAS: 13532-37-1	Min. 95%	To inquire	Wed 07 May 25