CAS 1353224-61-9
:3-Hydroxy-2-[3-methoxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one
Description:
3-Hydroxy-2-[3-methoxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one, with the CAS number 1353224-61-9, is a synthetic organic compound characterized by its complex structure, which includes a naphthopyran backbone and various functional groups. This compound features a hydroxyl group, a methoxy group, and a pyrrolidine moiety, contributing to its potential biological activity. The presence of the naphtho[1,2-b]pyran structure suggests that it may exhibit interesting photophysical properties, possibly making it useful in applications such as fluorescence or as a dye. Additionally, the pyrrolidine ring may impart unique pharmacological properties, potentially influencing its interaction with biological targets. The compound's solubility, stability, and reactivity can vary based on the functional groups present, which may also affect its bioavailability and therapeutic potential. Overall, this compound represents a class of molecules that could be of interest in medicinal chemistry and materials science, warranting further investigation into its properties and applications.
Formula:C24H21NO4
InChI:InChI=1S/C24H21NO4/c1-28-20-14-16(9-11-19(20)25-12-4-5-13-25)23-22(27)21(26)18-10-8-15-6-2-3-7-17(15)24(18)29-23/h2-3,6-11,14,27H,4-5,12-13H2,1H3
InChI key:InChIKey=ZJYFLTGQGIZYOU-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C3C(=CC2)C=CC=C3)OC(=C1O)C4=CC(OC)=C(C=C4)N5CCCC5
Synonyms:- 3-Hydroxy-2-[3-methoxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one
- 4H-Naphtho[1,2-b]pyran-4-one, 3-hydroxy-2-[3-methoxy-4-(1-pyrrolidinyl)phenyl]-
- 3-Hydroxy-2-[3-Methoxy-4-(pyrrolidin-1-yl)phenyl]benzo[h]chroMen-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.