CymitQuimica logo

CAS 1353224-63-1

:

3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one

Description:
3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one, with the CAS number 1353224-63-1, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a naphthopyran framework. This compound features multiple hydroxyl groups, contributing to its potential solubility in polar solvents and influencing its reactivity. The presence of a pyrrolidine moiety suggests possible interactions with biological systems, potentially indicating pharmacological activity. Its structural characteristics may allow for hydrogen bonding and π-π stacking interactions, which are significant in biological and chemical processes. The compound's unique arrangement of functional groups may also impart specific optical properties, making it of interest in fields such as medicinal chemistry and materials science. Overall, this compound's intricate structure and functional diversity position it as a candidate for further research in various applications, including drug development and organic synthesis.
Formula:C23H19NO4
InChI:InChI=1S/C23H19NO4/c25-19-13-15(8-10-18(19)24-11-3-4-12-24)22-21(27)20(26)17-9-7-14-5-1-2-6-16(14)23(17)28-22/h1-2,5-10,13,25,27H,3-4,11-12H2
InChI key:InChIKey=FKXZGHWYWGMSSQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C3C(=CC2)C=CC=C3)OC(=C1O)C4=CC(O)=C(C=C4)N5CCCC5
Synonyms:
  • 4H-Naphtho[1,2-b]pyran-4-one, 3-hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-
  • 3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-4H-naphtho[1,2-b]pyran-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.