CAS 1353224-67-5
:3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-6,7-dimethyl-4H-1-benzopyran-4-one
Description:
3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-6,7-dimethyl-4H-1-benzopyran-4-one, with the CAS number 1353224-67-5, is a synthetic organic compound that belongs to the class of flavonoids. This compound features a complex structure characterized by a benzopyran core, which is a common motif in flavonoids, and includes multiple hydroxyl groups that contribute to its potential biological activity. The presence of a pyrrolidine moiety suggests possible interactions with biological targets, enhancing its pharmacological profile. Its hydroxyl groups may also impart antioxidant properties, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can be influenced by its functional groups, which may affect its behavior in biological systems. Overall, this compound's unique structure and functional groups position it as a candidate for further research in areas such as pharmacology and biochemistry, particularly in the context of its potential therapeutic applications.
Formula:C21H21NO4
InChI:InChI=1S/C21H21NO4/c1-12-9-15-18(10-13(12)2)26-21(20(25)19(15)24)14-5-6-16(17(23)11-14)22-7-3-4-8-22/h5-6,9-11,23,25H,3-4,7-8H2,1-2H3
InChI key:InChIKey=GZBMQCNHVIBXLU-UHFFFAOYSA-N
SMILES:OC1=C(OC=2C(C1=O)=CC(C)=C(C)C2)C3=CC(O)=C(C=C3)N4CCCC4
Synonyms:- 4H-1-Benzopyran-4-one, 3-hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-6,7-dimethyl-
- 3-Hydroxy-2-[3-hydroxy-4-(1-pyrrolidinyl)phenyl]-6,7-dimethyl-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.